(2E,4E)-5-(3-oxo-4H-1,4-benzoxazin-6-yl)hexa-2,4-dienoic acid

C14H13NO4 — CID 116822556

IUPAC(2E,4E)-5-(3-oxo-4H-1,4-benzoxazin-6-yl)hexa-2,4-dienoic acid
SMILESC/C(=C\C=C\C(=O)O)c1ccc2c(c1)NC(=O)CO2
InChIInChI=1S/C14H13NO4/c1-9(3-2-4-14(17)18)10-5-6-12-11(7-10)15-13(16)8-19-12/h2-7H,8H2,1H3,(H,15,16)(H,17,18)/b4-2+,9-3+
InChIKeyFWKRFIMRDKQHHT-QIAUARBPSA-N
MW259.26 g/mol
LogP2.06
Rot. Bonds3

About (2E,4E)-5-(3-oxo-4H-1,4-benzoxazin-6-yl)hexa-2,4-dienoic acid

(2E,4E)-5-(3-oxo-4H-1,4-benzoxazin-6-yl)hexa-2,4-dienoic acid (PubChem CID 116822556) has the molecular formula C14H13NO4 and a molecular weight of 259.26 g/mol. Its IUPAC name is (2E,4E)-5-(3-oxo-4H-1,4-benzoxazin-6-yl)hexa-2,4-dienoic acid.

Molecular Properties

Compound Name(2E,4E)-5-(3-oxo-4H-1,4-benzoxazin-6-yl)hexa-2,4-dienoic acid
PubChem CID116822556
Molecular FormulaC14H13NO4
Molecular Weight259.26 g/mol
Exact Mass259.08
IUPAC Name(2E,4E)-5-(3-oxo-4H-1,4-benzoxazin-6-yl)hexa-2,4-dienoic acid
SMILESC/C(=C\C=C\C(=O)O)c1ccc2c(c1)NC(=O)CO2
InChIInChI=1S/C14H13NO4/c1-9(3-2-4-14(17)18)10-5-6-12-11(7-10)15-13(16)8-19-12/h2-7H,8H2,1H3,(H,15,16)(H,17,18)/b4-2+,9-3+
InChIKeyFWKRFIMRDKQHHT-QIAUARBPSA-N
XLogP2.06
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500259.26
LogP ≤ 52.06
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze (2E,4E)-5-(3-oxo-4H-1,4-benzoxazin-6-yl)hexa-2,4-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2E,4E)-5-(3-oxo-4H-1,4-benzoxazin-6-yl)hexa-2,4-dienoic acid?
The IUPAC name of (2E,4E)-5-(3-oxo-4H-1,4-benzoxazin-6-yl)hexa-2,4-dienoic acid (CID 116822556) is (2E,4E)-5-(3-oxo-4H-1,4-benzoxazin-6-yl)hexa-2,4-dienoic acid.
What is the SMILES notation for (2E,4E)-5-(3-oxo-4H-1,4-benzoxazin-6-yl)hexa-2,4-dienoic acid?
The canonical SMILES for (2E,4E)-5-(3-oxo-4H-1,4-benzoxazin-6-yl)hexa-2,4-dienoic acid is C/C(=C\C=C\C(=O)O)c1ccc2c(c1)NC(=O)CO2.
What is the InChIKey of (2E,4E)-5-(3-oxo-4H-1,4-benzoxazin-6-yl)hexa-2,4-dienoic acid?
The InChIKey is FWKRFIMRDKQHHT-QIAUARBPSA-N. The full InChI is InChI=1S/C14H13NO4/c1-9(3-2-4-14(17)18)10-5-6-12-11(7-10)15-13(16)8-19-12/h2-7H,8H2,1H3,(H,15,16)(H,17,18)/b4-2+,9-3+.
What are the key properties of (2E,4E)-5-(3-oxo-4H-1,4-benzoxazin-6-yl)hexa-2,4-dienoic acid?
(2E,4E)-5-(3-oxo-4H-1,4-benzoxazin-6-yl)hexa-2,4-dienoic acid has a molecular weight of 259.26 g/mol, XLogP of 2.06, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4E)-5-(3-oxo-4H-1,4-benzoxazin-6-yl)hexa-2,4-dienoic acid is sourced from PubChem (CID 116822556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).