C14H13NO4 — CID 116822556
(2E,4E)-5-(3-oxo-4H-1,4-benzoxazin-6-yl)hexa-2,4-dienoic acid (PubChem CID 116822556) has the molecular formula C14H13NO4 and a molecular weight of 259.26 g/mol. Its IUPAC name is (2E,4E)-5-(3-oxo-4H-1,4-benzoxazin-6-yl)hexa-2,4-dienoic acid.
| Compound Name | (2E,4E)-5-(3-oxo-4H-1,4-benzoxazin-6-yl)hexa-2,4-dienoic acid |
|---|---|
| PubChem CID | 116822556 |
| Molecular Formula | C14H13NO4 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | (2E,4E)-5-(3-oxo-4H-1,4-benzoxazin-6-yl)hexa-2,4-dienoic acid |
| SMILES | C/C(=C\C=C\C(=O)O)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C14H13NO4/c1-9(3-2-4-14(17)18)10-5-6-12-11(7-10)15-13(16)8-19-12/h2-7H,8H2,1H3,(H,15,16)(H,17,18)/b4-2+,9-3+ |
| InChIKey | FWKRFIMRDKQHHT-QIAUARBPSA-N |
| XLogP | 2.06 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|