C12H12ClN3O — CID 116822857
5-chloro-6-(4-methoxy-2,5-dimethylphenyl)-1,2,4-triazine (PubChem CID 116822857) has the molecular formula C12H12ClN3O and a molecular weight of 249.70 g/mol. Its IUPAC name is 5-chloro-6-(4-methoxy-2,5-dimethylphenyl)-1,2,4-triazine.
| Compound Name | 5-chloro-6-(4-methoxy-2,5-dimethylphenyl)-1,2,4-triazine |
|---|---|
| PubChem CID | 116822857 |
| Molecular Formula | C12H12ClN3O |
| Molecular Weight | 249.70 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 5-chloro-6-(4-methoxy-2,5-dimethylphenyl)-1,2,4-triazine |
| SMILES | COc1cc(C)c(-c2nncnc2Cl)cc1C |
| InChI | InChI=1S/C12H12ClN3O/c1-7-5-10(17-3)8(2)4-9(7)11-12(13)14-6-15-16-11/h4-6H,1-3H3 |
| InChIKey | JNYZOQBPZBMAAV-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.70 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |