C10H17N5 — CID 116823993
5-piperazin-1-yl-3-propyl-1,2,4-triazine (PubChem CID 116823993) has the molecular formula C10H17N5 and a molecular weight of 207.28 g/mol. Its IUPAC name is 5-piperazin-1-yl-3-propyl-1,2,4-triazine.
| Compound Name | 5-piperazin-1-yl-3-propyl-1,2,4-triazine |
|---|---|
| PubChem CID | 116823993 |
| Molecular Formula | C10H17N5 |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.15 |
| IUPAC Name | 5-piperazin-1-yl-3-propyl-1,2,4-triazine |
| SMILES | CCCc1nncc(N2CCNCC2)n1 |
| InChI | InChI=1S/C10H17N5/c1-2-3-9-13-10(8-12-14-9)15-6-4-11-5-7-15/h8,11H,2-7H2,1H3 |
| InChIKey | FKCAVKCWEXCKMS-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |