C11H19N5 — CID 116823995
3-tert-butyl-5-piperazin-1-yl-1,2,4-triazine (PubChem CID 116823995) has the molecular formula C11H19N5 and a molecular weight of 221.31 g/mol. Its IUPAC name is 3-tert-butyl-5-piperazin-1-yl-1,2,4-triazine.
| Compound Name | 3-tert-butyl-5-piperazin-1-yl-1,2,4-triazine |
|---|---|
| PubChem CID | 116823995 |
| Molecular Formula | C11H19N5 |
| Molecular Weight | 221.31 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 3-tert-butyl-5-piperazin-1-yl-1,2,4-triazine |
| SMILES | CC(C)(C)c1nncc(N2CCNCC2)n1 |
| InChI | InChI=1S/C11H19N5/c1-11(2,3)10-14-9(8-13-15-10)16-6-4-12-5-7-16/h8,12H,4-7H2,1-3H3 |
| InChIKey | WRUGMGKTRGXUFL-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.31 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |