C10H10N2O2S2 — CID 116824090
2-methylsulfanyl-5-(3-methylthiophen-2-yl)-1H-imidazole-4-carboxylic acid (PubChem CID 116824090) has the molecular formula C10H10N2O2S2 and a molecular weight of 254.34 g/mol. Its IUPAC name is 2-methylsulfanyl-5-(3-methylthiophen-2-yl)-1H-imidazole-4-carboxylic acid.
| Compound Name | 2-methylsulfanyl-5-(3-methylthiophen-2-yl)-1H-imidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 116824090 |
| Molecular Formula | C10H10N2O2S2 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | 2-methylsulfanyl-5-(3-methylthiophen-2-yl)-1H-imidazole-4-carboxylic acid |
| SMILES | CSc1nc(C(=O)O)c(-c2sccc2C)[nH]1 |
| InChI | InChI=1S/C10H10N2O2S2/c1-5-3-4-16-8(5)6-7(9(13)14)12-10(11-6)15-2/h3-4H,1-2H3,(H,11,12)(H,13,14) |
| InChIKey | CIMAGKGZXDQAAP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |