C10H10N2O2S2 — CID 116824110
methyl 5-(3-methylthiophen-2-yl)-2-sulfanylidene-1,3-dihydroimidazole-4-carboxylate (PubChem CID 116824110) has the molecular formula C10H10N2O2S2 and a molecular weight of 254.34 g/mol. Its IUPAC name is methyl 5-(3-methylthiophen-2-yl)-2-sulfanylidene-1,3-dihydroimidazole-4-carboxylate.
| Compound Name | methyl 5-(3-methylthiophen-2-yl)-2-sulfanylidene-1,3-dihydroimidazole-4-carboxylate |
|---|---|
| PubChem CID | 116824110 |
| Molecular Formula | C10H10N2O2S2 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | methyl 5-(3-methylthiophen-2-yl)-2-sulfanylidene-1,3-dihydroimidazole-4-carboxylate |
| SMILES | COC(=O)c1[nH]c(=S)[nH]c1-c1sccc1C |
| InChI | InChI=1S/C10H10N2O2S2/c1-5-3-4-16-8(5)6-7(9(13)14-2)12-10(15)11-6/h3-4H,1-2H3,(H2,11,12,15) |
| InChIKey | AMCHUZLEILGBLM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 57.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|