C31H34O — CID 11683247
[(E,3S,4R)-5-methyl-8-phenyl-3-phenylmethoxy-4-propan-2-yloct-5-en-1-ynyl]benzene (PubChem CID 11683247) has the molecular formula C31H34O and a molecular weight of 422.61 g/mol. Its IUPAC name is [(E,3S,4R)-5-methyl-8-phenyl-3-phenylmethoxy-4-propan-2-yloct-5-en-1-ynyl]benzene.
| Compound Name | [(E,3S,4R)-5-methyl-8-phenyl-3-phenylmethoxy-4-propan-2-yloct-5-en-1-ynyl]benzene |
|---|---|
| PubChem CID | 11683247 |
| Molecular Formula | C31H34O |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | [(E,3S,4R)-5-methyl-8-phenyl-3-phenylmethoxy-4-propan-2-yloct-5-en-1-ynyl]benzene |
| SMILES | C/C(=C\CCc1ccccc1)[C@@H](C(C)C)[C@@H](C#Cc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C31H34O/c1-25(2)31(26(3)14-13-21-27-15-7-4-8-16-27)30(23-22-28-17-9-5-10-18-28)32-24-29-19-11-6-12-20-29/h4-12,14-20,25,30-31H,13,21,24H2,1-3H3/b26-14+/t30-,31-/m1/s1 |
| InChIKey | MDRFSXNATSRMTD-ZFVJVRHASA-N |
| XLogP | 7.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|