C29H30N4O4 — CID 11684723
2-morpholin-4-yl-2-oxo-N-[4-[(E)-3-(2-piperidin-1-ylquinolin-3-yl)prop-2-enoyl]phenyl]acetamide (PubChem CID 11684723) has the molecular formula C29H30N4O4 and a molecular weight of 498.58 g/mol. Its IUPAC name is 2-morpholin-4-yl-2-oxo-N-[4-[(E)-3-(2-piperidin-1-ylquinolin-3-yl)prop-2-enoyl]phenyl]acetamide.
| Compound Name | 2-morpholin-4-yl-2-oxo-N-[4-[(E)-3-(2-piperidin-1-ylquinolin-3-yl)prop-2-enoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 11684723 |
| Molecular Formula | C29H30N4O4 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | 2-morpholin-4-yl-2-oxo-N-[4-[(E)-3-(2-piperidin-1-ylquinolin-3-yl)prop-2-enoyl]phenyl]acetamide |
| SMILES | O=C(Nc1ccc(C(=O)/C=C/c2cc3ccccc3nc2N2CCCCC2)cc1)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C29H30N4O4/c34-26(21-8-11-24(12-9-21)30-28(35)29(36)33-16-18-37-19-17-33)13-10-23-20-22-6-2-3-7-25(22)31-27(23)32-14-4-1-5-15-32/h2-3,6-13,20H,1,4-5,14-19H2,(H,30,35)/b13-10+ |
| InChIKey | ODPWBTIZLDETSL-JLHYYAGUSA-N |
| XLogP | 3.92 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|