C32H29N5O2 — CID 156580186
(E)-1-[4-[(1-phenyltriazol-4-yl)methoxy]phenyl]-3-(2-piperidin-1-ylquinolin-3-yl)prop-2-en-1-one (PubChem CID 156580186) has the molecular formula C32H29N5O2 and a molecular weight of 515.62 g/mol. Its IUPAC name is (E)-1-[4-[(1-phenyltriazol-4-yl)methoxy]phenyl]-3-(2-piperidin-1-ylquinolin-3-yl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-[(1-phenyltriazol-4-yl)methoxy]phenyl]-3-(2-piperidin-1-ylquinolin-3-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 156580186 |
| Molecular Formula | C32H29N5O2 |
| Molecular Weight | 515.62 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | (E)-1-[4-[(1-phenyltriazol-4-yl)methoxy]phenyl]-3-(2-piperidin-1-ylquinolin-3-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cc2ccccc2nc1N1CCCCC1)c1ccc(OCc2cn(-c3ccccc3)nn2)cc1 |
| InChI | InChI=1S/C32H29N5O2/c38-31(18-15-26-21-25-9-5-6-12-30(25)33-32(26)36-19-7-2-8-20-36)24-13-16-29(17-14-24)39-23-27-22-37(35-34-27)28-10-3-1-4-11-28/h1,3-6,9-18,21-22H,2,7-8,19-20,23H2/b18-15+ |
| InChIKey | HUZCGTWNFZXKBD-OBGWFSINSA-N |
| XLogP | 6.28 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.62 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|