C29H23N3O6 — CID 118711277
7-[[1-[4-[(E)-3-(2,3-dimethoxyphenyl)prop-2-enoyl]phenyl]triazol-4-yl]methoxy]chromen-2-one (PubChem CID 118711277) has the molecular formula C29H23N3O6 and a molecular weight of 509.52 g/mol. Its IUPAC name is 7-[[1-[4-[(E)-3-(2,3-dimethoxyphenyl)prop-2-enoyl]phenyl]triazol-4-yl]methoxy]chromen-2-one.
| Compound Name | 7-[[1-[4-[(E)-3-(2,3-dimethoxyphenyl)prop-2-enoyl]phenyl]triazol-4-yl]methoxy]chromen-2-one |
|---|---|
| PubChem CID | 118711277 |
| Molecular Formula | C29H23N3O6 |
| Molecular Weight | 509.52 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | 7-[[1-[4-[(E)-3-(2,3-dimethoxyphenyl)prop-2-enoyl]phenyl]triazol-4-yl]methoxy]chromen-2-one |
| SMILES | COc1cccc(/C=C/C(=O)c2ccc(-n3cc(COc4ccc5ccc(=O)oc5c4)nn3)cc2)c1OC |
| InChI | InChI=1S/C29H23N3O6/c1-35-26-5-3-4-21(29(26)36-2)9-14-25(33)19-6-11-23(12-7-19)32-17-22(30-31-32)18-37-24-13-8-20-10-15-28(34)38-27(20)16-24/h3-17H,18H2,1-2H3/b14-9+ |
| InChIKey | TXCKVPNEJNLISB-NTEUORMPSA-N |
| XLogP | 4.87 |
| TPSA | 105.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.52 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|