C12H18O2S — CID 116852570
2-(2-methoxy-4,6-dimethylphenyl)sulfanylpropan-1-ol (PubChem CID 116852570) has the molecular formula C12H18O2S and a molecular weight of 226.34 g/mol. Its IUPAC name is 2-(2-methoxy-4,6-dimethylphenyl)sulfanylpropan-1-ol.
| Compound Name | 2-(2-methoxy-4,6-dimethylphenyl)sulfanylpropan-1-ol |
|---|---|
| PubChem CID | 116852570 |
| Molecular Formula | C12H18O2S |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 2-(2-methoxy-4,6-dimethylphenyl)sulfanylpropan-1-ol |
| SMILES | COc1cc(C)cc(C)c1SC(C)CO |
| InChI | InChI=1S/C12H18O2S/c1-8-5-9(2)12(11(6-8)14-4)15-10(3)7-13/h5-6,10,13H,7H2,1-4H3 |
| InChIKey | IGEODQAQXDQTTG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |