C14H22OS — CID 116852669
2-(4-tert-butyl-2,6-dimethylphenyl)sulfanylethanol (PubChem CID 116852669) has the molecular formula C14H22OS and a molecular weight of 238.40 g/mol. Its IUPAC name is 2-(4-tert-butyl-2,6-dimethylphenyl)sulfanylethanol.
| Compound Name | 2-(4-tert-butyl-2,6-dimethylphenyl)sulfanylethanol |
|---|---|
| PubChem CID | 116852669 |
| Molecular Formula | C14H22OS |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 2-(4-tert-butyl-2,6-dimethylphenyl)sulfanylethanol |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1SCCO |
| InChI | InChI=1S/C14H22OS/c1-10-8-12(14(3,4)5)9-11(2)13(10)16-7-6-15/h8-9,15H,6-7H2,1-5H3 |
| InChIKey | AXPMCFWIQOZESL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |