C24H34O2S3 — CID 139950677
2-[4-[4-(2-hydroxyethylsulfanyl)-2,3,5,6-tetramethylphenyl]sulfanyl-2,3,5,6-tetramethylphenyl]sulfanylethanol (PubChem CID 139950677) has the molecular formula C24H34O2S3 and a molecular weight of 450.74 g/mol. Its IUPAC name is 2-[4-[4-(2-hydroxyethylsulfanyl)-2,3,5,6-tetramethylphenyl]sulfanyl-2,3,5,6-tetramethylphenyl]sulfanylethanol.
| Compound Name | 2-[4-[4-(2-hydroxyethylsulfanyl)-2,3,5,6-tetramethylphenyl]sulfanyl-2,3,5,6-tetramethylphenyl]sulfanylethanol |
|---|---|
| PubChem CID | 139950677 |
| Molecular Formula | C24H34O2S3 |
| Molecular Weight | 450.74 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | 2-[4-[4-(2-hydroxyethylsulfanyl)-2,3,5,6-tetramethylphenyl]sulfanyl-2,3,5,6-tetramethylphenyl]sulfanylethanol |
| SMILES | Cc1c(C)c(Sc2c(C)c(C)c(SCCO)c(C)c2C)c(C)c(C)c1SCCO |
| InChI | InChI=1S/C24H34O2S3/c1-13-17(5)23(18(6)14(2)21(13)27-11-9-25)29-24-19(7)15(3)22(28-12-10-26)16(4)20(24)8/h25-26H,9-12H2,1-8H3 |
| InChIKey | OGNSPJGICCXVAH-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.74 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |