C14H21ClN2O — CID 116856400
2-(5-chloro-4-methoxy-2-methylphenyl)-1,4-dimethylpiperazine (PubChem CID 116856400) has the molecular formula C14H21ClN2O and a molecular weight of 268.79 g/mol. Its IUPAC name is 2-(5-chloro-4-methoxy-2-methylphenyl)-1,4-dimethylpiperazine.
| Compound Name | 2-(5-chloro-4-methoxy-2-methylphenyl)-1,4-dimethylpiperazine |
|---|---|
| PubChem CID | 116856400 |
| Molecular Formula | C14H21ClN2O |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 2-(5-chloro-4-methoxy-2-methylphenyl)-1,4-dimethylpiperazine |
| SMILES | COc1cc(C)c(C2CN(C)CCN2C)cc1Cl |
| InChI | InChI=1S/C14H21ClN2O/c1-10-7-14(18-4)12(15)8-11(10)13-9-16(2)5-6-17(13)3/h7-8,13H,5-6,9H2,1-4H3 |
| InChIKey | FDQJOLPVJTYRJJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |