C37H33ClN4O8 — CID 11686244
tert-butyl (2R,3R,4S,5S)-3,4-dibenzoyloxy-2-(benzoyloxymethyl)-5-(4-chloro-5H-pyrrolo[3,2-d]pyrimidin-7-yl)pyrrolidine-1-carboxylate (PubChem CID 11686244) has the molecular formula C37H33ClN4O8 and a molecular weight of 697.14 g/mol. Its IUPAC name is tert-butyl (2R,3R,4S,5S)-3,4-dibenzoyloxy-2-(benzoyloxymethyl)-5-(4-chloro-5H-pyrrolo[3,2-d]pyrimidin-7-yl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3R,4S,5S)-3,4-dibenzoyloxy-2-(benzoyloxymethyl)-5-(4-chloro-5H-pyrrolo[3,2-d]pyrimidin-7-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11686244 |
| Molecular Formula | C37H33ClN4O8 |
| Molecular Weight | 697.14 g/mol |
| Exact Mass | 696.20 |
| IUPAC Name | tert-butyl (2R,3R,4S,5S)-3,4-dibenzoyloxy-2-(benzoyloxymethyl)-5-(4-chloro-5H-pyrrolo[3,2-d]pyrimidin-7-yl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H](COC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@@H]1c1c[nH]c2c(Cl)ncnc12 |
| InChI | InChI=1S/C37H33ClN4O8/c1-37(2,3)50-36(46)42-26(20-47-33(43)22-13-7-4-8-14-22)30(48-34(44)23-15-9-5-10-16-23)31(49-35(45)24-17-11-6-12-18-24)29(42)25-19-39-28-27(25)40-21-41-32(28)38/h4-19,21,26,29-31,39H,20H2,1-3H3/t26-,29+,30-,31+/m1/s1 |
| InChIKey | ZSPTVWLSTRRYSY-ZSEZPNIJSA-N |
| XLogP | 6.58 |
| TPSA | 150.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.14 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|