C24H18ClFN4O5 — CID 87182815
[(2R,3R,4R,5S)-3-benzoyloxy-5-(6-chloro-7H-purin-8-yl)-4-fluorooxolan-2-yl]methyl benzoate (PubChem CID 87182815) has the molecular formula C24H18ClFN4O5 and a molecular weight of 496.88 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-3-benzoyloxy-5-(6-chloro-7H-purin-8-yl)-4-fluorooxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R,5S)-3-benzoyloxy-5-(6-chloro-7H-purin-8-yl)-4-fluorooxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 87182815 |
| Molecular Formula | C24H18ClFN4O5 |
| Molecular Weight | 496.88 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | [(2R,3R,4R,5S)-3-benzoyloxy-5-(6-chloro-7H-purin-8-yl)-4-fluorooxolan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1O[C@@H](c2nc3ncnc(Cl)c3[nH]2)[C@@H](F)[C@@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H18ClFN4O5/c25-20-17-21(28-12-27-20)30-22(29-17)19-16(26)18(35-24(32)14-9-5-2-6-10-14)15(34-19)11-33-23(31)13-7-3-1-4-8-13/h1-10,12,15-16,18-19H,11H2,(H,27,28,29,30)/t15-,16+,18-,19-/m1/s1 |
| InChIKey | RGDLPRNFRRJHBU-UKBAYJJMSA-N |
| XLogP | 3.87 |
| TPSA | 116.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.88 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |