C13H16O4S — CID 116872423
3-(2,5-dimethoxy-4-methylsulfanylphenyl)oxetane-3-carbaldehyde (PubChem CID 116872423) has the molecular formula C13H16O4S and a molecular weight of 268.33 g/mol. Its IUPAC name is 3-(2,5-dimethoxy-4-methylsulfanylphenyl)oxetane-3-carbaldehyde.
| Compound Name | 3-(2,5-dimethoxy-4-methylsulfanylphenyl)oxetane-3-carbaldehyde |
|---|---|
| PubChem CID | 116872423 |
| Molecular Formula | C13H16O4S |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 3-(2,5-dimethoxy-4-methylsulfanylphenyl)oxetane-3-carbaldehyde |
| SMILES | COc1cc(C2(C=O)COC2)c(OC)cc1SC |
| InChI | InChI=1S/C13H16O4S/c1-15-10-5-12(18-3)11(16-2)4-9(10)13(6-14)7-17-8-13/h4-6H,7-8H2,1-3H3 |
| InChIKey | JYEIFCGOSKWMKK-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|