C13H13NO4 — CID 116873514
methyl 3-(2-oxo-1,3-dihydroindol-5-yl)oxetane-3-carboxylate (PubChem CID 116873514) has the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. Its IUPAC name is methyl 3-(2-oxo-1,3-dihydroindol-5-yl)oxetane-3-carboxylate.
| Compound Name | methyl 3-(2-oxo-1,3-dihydroindol-5-yl)oxetane-3-carboxylate |
|---|---|
| PubChem CID | 116873514 |
| Molecular Formula | C13H13NO4 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | methyl 3-(2-oxo-1,3-dihydroindol-5-yl)oxetane-3-carboxylate |
| SMILES | COC(=O)C1(c2ccc3c(c2)CC(=O)N3)COC1 |
| InChI | InChI=1S/C13H13NO4/c1-17-12(16)13(6-18-7-13)9-2-3-10-8(4-9)5-11(15)14-10/h2-4H,5-7H2,1H3,(H,14,15) |
| InChIKey | CFTOZGUDTFDZQB-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |