C13H15NO2S — CID 116872550
5-[3-(2-sulfanylethyl)oxetan-3-yl]-1,3-dihydroindol-2-one (PubChem CID 116872550) has the molecular formula C13H15NO2S and a molecular weight of 249.33 g/mol. Its IUPAC name is 5-[3-(2-sulfanylethyl)oxetan-3-yl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[3-(2-sulfanylethyl)oxetan-3-yl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 116872550 |
| Molecular Formula | C13H15NO2S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 5-[3-(2-sulfanylethyl)oxetan-3-yl]-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(C3(CCS)COC3)ccc2N1 |
| InChI | InChI=1S/C13H15NO2S/c15-12-6-9-5-10(1-2-11(9)14-12)13(3-4-17)7-16-8-13/h1-2,5,17H,3-4,6-8H2,(H,14,15) |
| InChIKey | GPBNQWPDDPHUIP-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|