C13H15NO4 — CID 116871605
6-[3-(2-hydroxyethyl)oxetan-3-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 116871605) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is 6-[3-(2-hydroxyethyl)oxetan-3-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[3-(2-hydroxyethyl)oxetan-3-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 116871605 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 6-[3-(2-hydroxyethyl)oxetan-3-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(C3(CCO)COC3)cc2N1 |
| InChI | InChI=1S/C13H15NO4/c15-4-3-13(7-17-8-13)9-1-2-11-10(5-9)14-12(16)6-18-11/h1-2,5,15H,3-4,6-8H2,(H,14,16) |
| InChIKey | MWTRPCOWVWJZPJ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |