C16H20O2S — CID 11687722
3-hydroxy-2-methyl-2-phenylsulfanyl-5-prop-1-en-2-ylcyclohexan-1-one (PubChem CID 11687722) has the molecular formula C16H20O2S and a molecular weight of 276.40 g/mol. Its IUPAC name is 3-hydroxy-2-methyl-2-phenylsulfanyl-5-prop-1-en-2-ylcyclohexan-1-one.
| Compound Name | 3-hydroxy-2-methyl-2-phenylsulfanyl-5-prop-1-en-2-ylcyclohexan-1-one |
|---|---|
| PubChem CID | 11687722 |
| Molecular Formula | C16H20O2S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 3-hydroxy-2-methyl-2-phenylsulfanyl-5-prop-1-en-2-ylcyclohexan-1-one |
| SMILES | C=C(C)C1CC(=O)C(C)(Sc2ccccc2)C(O)C1 |
| InChI | InChI=1S/C16H20O2S/c1-11(2)12-9-14(17)16(3,15(18)10-12)19-13-7-5-4-6-8-13/h4-8,12,14,17H,1,9-10H2,2-3H3 |
| InChIKey | GLVMTVSWQYCZFR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|