C17H22O4 — CID 11687880
(2-methyl-5,8-dioxo-8-phenyloctan-2-yl) acetate (PubChem CID 11687880) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is (2-methyl-5,8-dioxo-8-phenyloctan-2-yl) acetate.
| Compound Name | (2-methyl-5,8-dioxo-8-phenyloctan-2-yl) acetate |
|---|---|
| PubChem CID | 11687880 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | (2-methyl-5,8-dioxo-8-phenyloctan-2-yl) acetate |
| SMILES | CC(=O)OC(C)(C)CCC(=O)CCC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H22O4/c1-13(18)21-17(2,3)12-11-15(19)9-10-16(20)14-7-5-4-6-8-14/h4-8H,9-12H2,1-3H3 |
| InChIKey | KIKJCTQDJGJJPX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |