C19H29NO3 — CID 175630764
2-methylbutan-2-yl N-(2,2-dimethyl-5-oxo-5-phenylpentyl)carbamate (PubChem CID 175630764) has the molecular formula C19H29NO3 and a molecular weight of 319.44 g/mol. Its IUPAC name is 2-methylbutan-2-yl N-(2,2-dimethyl-5-oxo-5-phenylpentyl)carbamate.
| Compound Name | 2-methylbutan-2-yl N-(2,2-dimethyl-5-oxo-5-phenylpentyl)carbamate |
|---|---|
| PubChem CID | 175630764 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.44 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | 2-methylbutan-2-yl N-(2,2-dimethyl-5-oxo-5-phenylpentyl)carbamate |
| SMILES | CCC(C)(C)OC(=O)NCC(C)(C)CCC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H29NO3/c1-6-19(4,5)23-17(22)20-14-18(2,3)13-12-16(21)15-10-8-7-9-11-15/h7-11H,6,12-14H2,1-5H3,(H,20,22) |
| InChIKey | AKTJGJOHCSFDIR-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.44 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |