C11H9N3S — CID 116879571
4-(1H-indol-3-yl)-1,3-dihydroimidazole-2-thione (PubChem CID 116879571) has the molecular formula C11H9N3S and a molecular weight of 215.28 g/mol. Its IUPAC name is 4-(1H-indol-3-yl)-1,3-dihydroimidazole-2-thione.
| Compound Name | 4-(1H-indol-3-yl)-1,3-dihydroimidazole-2-thione |
|---|---|
| PubChem CID | 116879571 |
| Molecular Formula | C11H9N3S |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | 4-(1H-indol-3-yl)-1,3-dihydroimidazole-2-thione |
| SMILES | S=c1[nH]cc(-c2c[nH]c3ccccc23)[nH]1 |
| InChI | InChI=1S/C11H9N3S/c15-11-13-6-10(14-11)8-5-12-9-4-2-1-3-7(8)9/h1-6,12H,(H2,13,14,15) |
| InChIKey | UEUHLFVIJVQDBF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 47.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|