C12H14N2OS — CID 116879602
4-(2-methoxy-4,6-dimethylphenyl)-1,3-dihydroimidazole-2-thione (PubChem CID 116879602) has the molecular formula C12H14N2OS and a molecular weight of 234.32 g/mol. Its IUPAC name is 4-(2-methoxy-4,6-dimethylphenyl)-1,3-dihydroimidazole-2-thione.
| Compound Name | 4-(2-methoxy-4,6-dimethylphenyl)-1,3-dihydroimidazole-2-thione |
|---|---|
| PubChem CID | 116879602 |
| Molecular Formula | C12H14N2OS |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 4-(2-methoxy-4,6-dimethylphenyl)-1,3-dihydroimidazole-2-thione |
| SMILES | COc1cc(C)cc(C)c1-c1c[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C12H14N2OS/c1-7-4-8(2)11(10(5-7)15-3)9-6-13-12(16)14-9/h4-6H,1-3H3,(H2,13,14,16) |
| InChIKey | QCHOQWLGFKHFDN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 40.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|