C13H16N2OS — CID 116879627
4-(4-methoxy-2,3,6-trimethylphenyl)-1,3-dihydroimidazole-2-thione (PubChem CID 116879627) has the molecular formula C13H16N2OS and a molecular weight of 248.35 g/mol. Its IUPAC name is 4-(4-methoxy-2,3,6-trimethylphenyl)-1,3-dihydroimidazole-2-thione.
| Compound Name | 4-(4-methoxy-2,3,6-trimethylphenyl)-1,3-dihydroimidazole-2-thione |
|---|---|
| PubChem CID | 116879627 |
| Molecular Formula | C13H16N2OS |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 4-(4-methoxy-2,3,6-trimethylphenyl)-1,3-dihydroimidazole-2-thione |
| SMILES | COc1cc(C)c(-c2c[nH]c(=S)[nH]2)c(C)c1C |
| InChI | InChI=1S/C13H16N2OS/c1-7-5-11(16-4)8(2)9(3)12(7)10-6-14-13(17)15-10/h5-6H,1-4H3,(H2,14,15,17) |
| InChIKey | XTFZDBUVBJOEMT-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 40.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|