C32H37N3O4 — CID 90444910
2-(2,4-dimethoxy-3,5-dimethylphenyl)-4-(2,4-dimethoxy-3,6-dimethylphenyl)-6-(2,4,6-trimethylphenyl)-1,3,5-triazine (PubChem CID 90444910) has the molecular formula C32H37N3O4 and a molecular weight of 527.67 g/mol. Its IUPAC name is 2-(2,4-dimethoxy-3,5-dimethylphenyl)-4-(2,4-dimethoxy-3,6-dimethylphenyl)-6-(2,4,6-trimethylphenyl)-1,3,5-triazine.
| Compound Name | 2-(2,4-dimethoxy-3,5-dimethylphenyl)-4-(2,4-dimethoxy-3,6-dimethylphenyl)-6-(2,4,6-trimethylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 90444910 |
| Molecular Formula | C32H37N3O4 |
| Molecular Weight | 527.67 g/mol |
| Exact Mass | 527.28 |
| IUPAC Name | 2-(2,4-dimethoxy-3,5-dimethylphenyl)-4-(2,4-dimethoxy-3,6-dimethylphenyl)-6-(2,4,6-trimethylphenyl)-1,3,5-triazine |
| SMILES | COc1cc(C)c(-c2nc(-c3cc(C)c(OC)c(C)c3OC)nc(-c3c(C)cc(C)cc3C)n2)c(OC)c1C |
| InChI | InChI=1S/C32H37N3O4/c1-16-12-17(2)25(18(3)13-16)31-33-30(23-14-20(5)27(37-9)22(7)28(23)38-10)34-32(35-31)26-19(4)15-24(36-8)21(6)29(26)39-11/h12-15H,1-11H3 |
| InChIKey | HXOFMHVOGHWKIY-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 75.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.67 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |