C21H30O3 — CID 11688522
(2S,3R,3aS,4R,6S,6aS)-4,6-bis(hydroxymethyl)-2-pentyl-3-phenyl-3,3a,4,5,6,6a-hexahydro-2H-pentalen-1-one (PubChem CID 11688522) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is (2S,3R,3aS,4R,6S,6aS)-4,6-bis(hydroxymethyl)-2-pentyl-3-phenyl-3,3a,4,5,6,6a-hexahydro-2H-pentalen-1-one.
| Compound Name | (2S,3R,3aS,4R,6S,6aS)-4,6-bis(hydroxymethyl)-2-pentyl-3-phenyl-3,3a,4,5,6,6a-hexahydro-2H-pentalen-1-one |
|---|---|
| PubChem CID | 11688522 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | (2S,3R,3aS,4R,6S,6aS)-4,6-bis(hydroxymethyl)-2-pentyl-3-phenyl-3,3a,4,5,6,6a-hexahydro-2H-pentalen-1-one |
| SMILES | CCCCC[C@@H]1C(=O)[C@@H]2[C@@H](CO)C[C@@H](CO)[C@@H]2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C21H30O3/c1-2-3-5-10-17-18(14-8-6-4-7-9-14)19-15(12-22)11-16(13-23)20(19)21(17)24/h4,6-9,15-20,22-23H,2-3,5,10-13H2,1H3/t15-,16+,17-,18-,19+,20+/m0/s1 |
| InChIKey | SNDWYYDTDBYVMX-GNVSMLMZSA-N |
| XLogP | 3.40 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|