C22H31FO2 — CID 145298434
[(3R)-1-[(1S,2R)-2-[(Z)-hex-2-enyl]-3-oxocyclopentyl]-5-phenylpentan-3-yl] hypofluorite (PubChem CID 145298434) has the molecular formula C22H31FO2 and a molecular weight of 346.49 g/mol. Its IUPAC name is [(3R)-1-[(1S,2R)-2-[(Z)-hex-2-enyl]-3-oxocyclopentyl]-5-phenylpentan-3-yl] hypofluorite.
| Compound Name | [(3R)-1-[(1S,2R)-2-[(Z)-hex-2-enyl]-3-oxocyclopentyl]-5-phenylpentan-3-yl] hypofluorite |
|---|---|
| PubChem CID | 145298434 |
| Molecular Formula | C22H31FO2 |
| Molecular Weight | 346.49 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | [(3R)-1-[(1S,2R)-2-[(Z)-hex-2-enyl]-3-oxocyclopentyl]-5-phenylpentan-3-yl] hypofluorite |
| SMILES | CCC/C=C\C[C@H]1C(=O)CC[C@@H]1CC[C@H](CCc1ccccc1)OF |
| InChI | InChI=1S/C22H31FO2/c1-2-3-4-8-11-21-19(14-17-22(21)24)13-16-20(25-23)15-12-18-9-6-5-7-10-18/h4-10,19-21H,2-3,11-17H2,1H3/b8-4-/t19-,20-,21+/m0/s1 |
| InChIKey | MGBZLBMWQIJKBM-YMGPWLLESA-N |
| XLogP | 6.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.49 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|