C12H18N2OS — CID 116888938
3-[2-(oxan-4-yl)-1,3-thiazol-4-yl]cyclobutan-1-amine (PubChem CID 116888938) has the molecular formula C12H18N2OS and a molecular weight of 238.36 g/mol. Its IUPAC name is 3-[2-(oxan-4-yl)-1,3-thiazol-4-yl]cyclobutan-1-amine.
| Compound Name | 3-[2-(oxan-4-yl)-1,3-thiazol-4-yl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 116888938 |
| Molecular Formula | C12H18N2OS |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 3-[2-(oxan-4-yl)-1,3-thiazol-4-yl]cyclobutan-1-amine |
| SMILES | NC1CC(c2csc(C3CCOCC3)n2)C1 |
| InChI | InChI=1S/C12H18N2OS/c13-10-5-9(6-10)11-7-16-12(14-11)8-1-3-15-4-2-8/h7-10H,1-6,13H2 |
| InChIKey | ZOQUOVITHKIABO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |