C15H19NOS — CID 116889795
2-(4-tert-butyl-2,6-dimethylphenyl)-1,3-thiazol-4-ol (PubChem CID 116889795) has the molecular formula C15H19NOS and a molecular weight of 261.39 g/mol. Its IUPAC name is 2-(4-tert-butyl-2,6-dimethylphenyl)-1,3-thiazol-4-ol.
| Compound Name | 2-(4-tert-butyl-2,6-dimethylphenyl)-1,3-thiazol-4-ol |
|---|---|
| PubChem CID | 116889795 |
| Molecular Formula | C15H19NOS |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 2-(4-tert-butyl-2,6-dimethylphenyl)-1,3-thiazol-4-ol |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1-c1nc(O)cs1 |
| InChI | InChI=1S/C15H19NOS/c1-9-6-11(15(3,4)5)7-10(2)13(9)14-16-12(17)8-18-14/h6-8,17H,1-5H3 |
| InChIKey | CNLPPDPPUJFWRC-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |