C9H6ClNO2S — CID 137224845
2-(2-chloro-4-hydroxyphenyl)-1,3-thiazol-4-ol (PubChem CID 137224845) has the molecular formula C9H6ClNO2S and a molecular weight of 227.67 g/mol. Its IUPAC name is 2-(2-chloro-4-hydroxyphenyl)-1,3-thiazol-4-ol.
| Compound Name | 2-(2-chloro-4-hydroxyphenyl)-1,3-thiazol-4-ol |
|---|---|
| PubChem CID | 137224845 |
| Molecular Formula | C9H6ClNO2S |
| Molecular Weight | 227.67 g/mol |
| Exact Mass | 226.98 |
| IUPAC Name | 2-(2-chloro-4-hydroxyphenyl)-1,3-thiazol-4-ol |
| SMILES | Oc1ccc(-c2nc(O)cs2)c(Cl)c1 |
| InChI | InChI=1S/C9H6ClNO2S/c10-7-3-5(12)1-2-6(7)9-11-8(13)4-14-9/h1-4,12-13H |
| InChIKey | VRSKHOYBFJUQKH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.67 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |