C13H16N2OS — CID 116890605
2-amino-2-[2-(3,4-dimethylphenyl)-1,3-thiazol-4-yl]ethanol (PubChem CID 116890605) has the molecular formula C13H16N2OS and a molecular weight of 248.35 g/mol. Its IUPAC name is 2-amino-2-[2-(3,4-dimethylphenyl)-1,3-thiazol-4-yl]ethanol.
| Compound Name | 2-amino-2-[2-(3,4-dimethylphenyl)-1,3-thiazol-4-yl]ethanol |
|---|---|
| PubChem CID | 116890605 |
| Molecular Formula | C13H16N2OS |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 2-amino-2-[2-(3,4-dimethylphenyl)-1,3-thiazol-4-yl]ethanol |
| SMILES | Cc1ccc(-c2nc(C(N)CO)cs2)cc1C |
| InChI | InChI=1S/C13H16N2OS/c1-8-3-4-10(5-9(8)2)13-15-12(7-17-13)11(14)6-16/h3-5,7,11,16H,6,14H2,1-2H3 |
| InChIKey | ACPYQCQEGTWAHR-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |