3-methyl-2-[2-(2-methylpropyl)-1,3-thiazol-4-yl]butanoic acid

C12H19NO2S — CID 116891257

IUPAC3-methyl-2-[2-(2-methylpropyl)-1,3-thiazol-4-yl]butanoic acid
SMILESCC(C)Cc1nc(C(C(=O)O)C(C)C)cs1
InChIInChI=1S/C12H19NO2S/c1-7(2)5-10-13-9(6-16-10)11(8(3)4)12(14)15/h6-8,11H,5H2,1-4H3,(H,14,15)
InChIKeyDJZBBGKAXAOIOU-UHFFFAOYSA-N
MW241.36 g/mol
LogP3.17
Rot. Bonds5

About 3-methyl-2-[2-(2-methylpropyl)-1,3-thiazol-4-yl]butanoic acid

3-methyl-2-[2-(2-methylpropyl)-1,3-thiazol-4-yl]butanoic acid (PubChem CID 116891257) has the molecular formula C12H19NO2S and a molecular weight of 241.36 g/mol. Its IUPAC name is 3-methyl-2-[2-(2-methylpropyl)-1,3-thiazol-4-yl]butanoic acid.

Molecular Properties

Compound Name3-methyl-2-[2-(2-methylpropyl)-1,3-thiazol-4-yl]butanoic acid
PubChem CID116891257
Molecular FormulaC12H19NO2S
Molecular Weight241.36 g/mol
Exact Mass241.11
IUPAC Name3-methyl-2-[2-(2-methylpropyl)-1,3-thiazol-4-yl]butanoic acid
SMILESCC(C)Cc1nc(C(C(=O)O)C(C)C)cs1
InChIInChI=1S/C12H19NO2S/c1-7(2)5-10-13-9(6-16-10)11(8(3)4)12(14)15/h6-8,11H,5H2,1-4H3,(H,14,15)
InChIKeyDJZBBGKAXAOIOU-UHFFFAOYSA-N
XLogP3.17
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.36
LogP ≤ 53.17
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-methyl-2-[2-(2-methylpropyl)-1,3-thiazol-4-yl]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methyl-2-[2-(2-methylpropyl)-1,3-thiazol-4-yl]butanoic acid?
The IUPAC name of 3-methyl-2-[2-(2-methylpropyl)-1,3-thiazol-4-yl]butanoic acid (CID 116891257) is 3-methyl-2-[2-(2-methylpropyl)-1,3-thiazol-4-yl]butanoic acid.
What is the SMILES notation for 3-methyl-2-[2-(2-methylpropyl)-1,3-thiazol-4-yl]butanoic acid?
The canonical SMILES for 3-methyl-2-[2-(2-methylpropyl)-1,3-thiazol-4-yl]butanoic acid is CC(C)Cc1nc(C(C(=O)O)C(C)C)cs1.
What is the InChIKey of 3-methyl-2-[2-(2-methylpropyl)-1,3-thiazol-4-yl]butanoic acid?
The InChIKey is DJZBBGKAXAOIOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO2S/c1-7(2)5-10-13-9(6-16-10)11(8(3)4)12(14)15/h6-8,11H,5H2,1-4H3,(H,14,15).
What are the key properties of 3-methyl-2-[2-(2-methylpropyl)-1,3-thiazol-4-yl]butanoic acid?
3-methyl-2-[2-(2-methylpropyl)-1,3-thiazol-4-yl]butanoic acid has a molecular weight of 241.36 g/mol, XLogP of 3.17, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-[2-(2-methylpropyl)-1,3-thiazol-4-yl]butanoic acid is sourced from PubChem (CID 116891257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).