C10H6ClN3OS — CID 116892313
5-(4-chloro-1,3-thiazol-2-yl)-1,3-dihydrobenzimidazol-2-one (PubChem CID 116892313) has the molecular formula C10H6ClN3OS and a molecular weight of 251.70 g/mol. Its IUPAC name is 5-(4-chloro-1,3-thiazol-2-yl)-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-(4-chloro-1,3-thiazol-2-yl)-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 116892313 |
| Molecular Formula | C10H6ClN3OS |
| Molecular Weight | 251.70 g/mol |
| Exact Mass | 250.99 |
| IUPAC Name | 5-(4-chloro-1,3-thiazol-2-yl)-1,3-dihydrobenzimidazol-2-one |
| SMILES | O=c1[nH]c2ccc(-c3nc(Cl)cs3)cc2[nH]1 |
| InChI | InChI=1S/C10H6ClN3OS/c11-8-4-16-9(14-8)5-1-2-6-7(3-5)13-10(15)12-6/h1-4H,(H2,12,13,15) |
| InChIKey | HRPNNOSUBFVOJL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.70 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |