C20H18FN3O3S — CID 73387404
5-[2-[4-fluoro-2-(2-methoxyethoxymethyl)phenyl]-1,3-thiazol-4-yl]-1,3-dihydrobenzimidazol-2-one (PubChem CID 73387404) has the molecular formula C20H18FN3O3S and a molecular weight of 399.45 g/mol. Its IUPAC name is 5-[2-[4-fluoro-2-(2-methoxyethoxymethyl)phenyl]-1,3-thiazol-4-yl]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-[2-[4-fluoro-2-(2-methoxyethoxymethyl)phenyl]-1,3-thiazol-4-yl]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 73387404 |
| Molecular Formula | C20H18FN3O3S |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | 5-[2-[4-fluoro-2-(2-methoxyethoxymethyl)phenyl]-1,3-thiazol-4-yl]-1,3-dihydrobenzimidazol-2-one |
| SMILES | COCCOCc1cc(F)ccc1-c1nc(-c2ccc3[nH]c(=O)[nH]c3c2)cs1 |
| InChI | InChI=1S/C20H18FN3O3S/c1-26-6-7-27-10-13-8-14(21)3-4-15(13)19-22-18(11-28-19)12-2-5-16-17(9-12)24-20(25)23-16/h2-5,8-9,11H,6-7,10H2,1H3,(H2,23,24,25) |
| InChIKey | LPZAAQGJQXBEMK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|