C20H20FN3O3S — CID 126489233
5-[2-[4-fluoro-2-(2-methoxyethoxymethyl)phenyl]-1,3-thiazol-4-yl]-2,3-dihydro-1H-benzimidazol-2-ol (PubChem CID 126489233) has the molecular formula C20H20FN3O3S and a molecular weight of 401.46 g/mol. Its IUPAC name is 5-[2-[4-fluoro-2-(2-methoxyethoxymethyl)phenyl]-1,3-thiazol-4-yl]-2,3-dihydro-1H-benzimidazol-2-ol.
| Compound Name | 5-[2-[4-fluoro-2-(2-methoxyethoxymethyl)phenyl]-1,3-thiazol-4-yl]-2,3-dihydro-1H-benzimidazol-2-ol |
|---|---|
| PubChem CID | 126489233 |
| Molecular Formula | C20H20FN3O3S |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 5-[2-[4-fluoro-2-(2-methoxyethoxymethyl)phenyl]-1,3-thiazol-4-yl]-2,3-dihydro-1H-benzimidazol-2-ol |
| SMILES | COCCOCc1cc(F)ccc1-c1nc(-c2ccc3c(c2)NC(O)N3)cs1 |
| InChI | InChI=1S/C20H20FN3O3S/c1-26-6-7-27-10-13-8-14(21)3-4-15(13)19-22-18(11-28-19)12-2-5-16-17(9-12)24-20(25)23-16/h2-5,8-9,11,20,23-25H,6-7,10H2,1H3 |
| InChIKey | XGSRNUGXQGGZCW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 75.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|