C21H20ClN3O3 — CID 11689807
7-(2-chloroethoxy)-4-[(2,3-dimethyl-1H-indol-6-yl)oxy]-6-methoxyquinazoline (PubChem CID 11689807) has the molecular formula C21H20ClN3O3 and a molecular weight of 397.86 g/mol. Its IUPAC name is 7-(2-chloroethoxy)-4-[(2,3-dimethyl-1H-indol-6-yl)oxy]-6-methoxyquinazoline.
| Compound Name | 7-(2-chloroethoxy)-4-[(2,3-dimethyl-1H-indol-6-yl)oxy]-6-methoxyquinazoline |
|---|---|
| PubChem CID | 11689807 |
| Molecular Formula | C21H20ClN3O3 |
| Molecular Weight | 397.86 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 7-(2-chloroethoxy)-4-[(2,3-dimethyl-1H-indol-6-yl)oxy]-6-methoxyquinazoline |
| SMILES | COc1cc2c(Oc3ccc4c(C)c(C)[nH]c4c3)ncnc2cc1OCCCl |
| InChI | InChI=1S/C21H20ClN3O3/c1-12-13(2)25-18-8-14(4-5-15(12)18)28-21-16-9-19(26-3)20(27-7-6-22)10-17(16)23-11-24-21/h4-5,8-11,25H,6-7H2,1-3H3 |
| InChIKey | DYRPODRPBUYEBX-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.86 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|