C14H13ClN4O3 — CID 173161815
6-(2-chloroethoxy)-7-methoxy-4-(1H-pyrazol-4-yloxy)quinazoline (PubChem CID 173161815) has the molecular formula C14H13ClN4O3 and a molecular weight of 320.74 g/mol. Its IUPAC name is 6-(2-chloroethoxy)-7-methoxy-4-(1H-pyrazol-4-yloxy)quinazoline.
| Compound Name | 6-(2-chloroethoxy)-7-methoxy-4-(1H-pyrazol-4-yloxy)quinazoline |
|---|---|
| PubChem CID | 173161815 |
| Molecular Formula | C14H13ClN4O3 |
| Molecular Weight | 320.74 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 6-(2-chloroethoxy)-7-methoxy-4-(1H-pyrazol-4-yloxy)quinazoline |
| SMILES | COc1cc2ncnc(Oc3cn[nH]c3)c2cc1OCCCl |
| InChI | InChI=1S/C14H13ClN4O3/c1-20-12-5-11-10(4-13(12)21-3-2-15)14(17-8-16-11)22-9-6-18-19-7-9/h4-8H,2-3H2,1H3,(H,18,19) |
| InChIKey | RBWSKQNSTZZUFN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 82.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.74 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|