C19H27NO10S — CID 11691158
methyl (1S,2S,6S,9R,11R)-11-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-4-sulfanylidene-3,5,8,12-tetraoxatricyclo[7.3.0.02,6]dodecane-11-carboxylate (PubChem CID 11691158) has the molecular formula C19H27NO10S and a molecular weight of 461.49 g/mol. Its IUPAC name is methyl (1S,2S,6S,9R,11R)-11-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-4-sulfanylidene-3,5,8,12-tetraoxatricyclo[7.3.0.02,6]dodecane-11-carboxylate.
| Compound Name | methyl (1S,2S,6S,9R,11R)-11-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-4-sulfanylidene-3,5,8,12-tetraoxatricyclo[7.3.0.02,6]dodecane-11-carboxylate |
|---|---|
| PubChem CID | 11691158 |
| Molecular Formula | C19H27NO10S |
| Molecular Weight | 461.49 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | methyl (1S,2S,6S,9R,11R)-11-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-4-sulfanylidene-3,5,8,12-tetraoxatricyclo[7.3.0.02,6]dodecane-11-carboxylate |
| SMILES | COC(=O)[C@H](C[C@]1(C(=O)OC)C[C@H]2OC[C@@H]3OC(=S)O[C@@H]3[C@H]2O1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H27NO10S/c1-18(2,3)30-16(23)20-9(14(21)24-4)6-19(15(22)25-5)7-10-13(29-19)12-11(8-26-10)27-17(31)28-12/h9-13H,6-8H2,1-5H3,(H,20,23)/t9-,10+,11-,12-,13-,19+/m0/s1 |
| InChIKey | DAWRJGZROSMLAI-MPWLVSFDSA-N |
| XLogP | 0.61 |
| TPSA | 127.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.49 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|