C20H31NO9 — CID 11069999
methyl (2S)-3-[(1S,2R,6R,9R,11R)-4,4-dimethyl-12-oxo-3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecan-11-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 11069999) has the molecular formula C20H31NO9 and a molecular weight of 429.47 g/mol. Its IUPAC name is methyl (2S)-3-[(1S,2R,6R,9R,11R)-4,4-dimethyl-12-oxo-3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecan-11-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | methyl (2S)-3-[(1S,2R,6R,9R,11R)-4,4-dimethyl-12-oxo-3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecan-11-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 11069999 |
| Molecular Formula | C20H31NO9 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | methyl (2S)-3-[(1S,2R,6R,9R,11R)-4,4-dimethyl-12-oxo-3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecan-11-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | COC(=O)[C@H](C[C@@H]1C[C@H]2OC[C@H]3OC(C)(C)O[C@H]3[C@H]2OC1=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H31NO9/c1-19(2,3)30-18(24)21-11(17(23)25-6)7-10-8-12-14(27-16(10)22)15-13(9-26-12)28-20(4,5)29-15/h10-15H,7-9H2,1-6H3,(H,21,24)/t10-,11+,12-,13-,14+,15-/m1/s1 |
| InChIKey | PUAWSTAOJZUKDO-ZAQNNHEOSA-N |
| XLogP | 1.29 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|