C13H29N3 — CID 116914005
N,N,2-trimethyl-2-piperazin-1-ylhexan-3-amine (PubChem CID 116914005) has the molecular formula C13H29N3 and a molecular weight of 227.40 g/mol. Its IUPAC name is N,N,2-trimethyl-2-piperazin-1-ylhexan-3-amine.
| Compound Name | N,N,2-trimethyl-2-piperazin-1-ylhexan-3-amine |
|---|---|
| PubChem CID | 116914005 |
| Molecular Formula | C13H29N3 |
| Molecular Weight | 227.40 g/mol |
| Exact Mass | 227.24 |
| IUPAC Name | N,N,2-trimethyl-2-piperazin-1-ylhexan-3-amine |
| SMILES | CCCC(N(C)C)C(C)(C)N1CCNCC1 |
| InChI | InChI=1S/C13H29N3/c1-6-7-12(15(4)5)13(2,3)16-10-8-14-9-11-16/h12,14H,6-11H2,1-5H3 |
| InChIKey | KTULLKWYNONRIL-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.40 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |