C9H13Cl2N3 — CID 116914952
1-(2,4-dichlorophenyl)-1-hydrazinyl-N,N-dimethylmethanamine (PubChem CID 116914952) has the molecular formula C9H13Cl2N3 and a molecular weight of 234.13 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-1-hydrazinyl-N,N-dimethylmethanamine.
| Compound Name | 1-(2,4-dichlorophenyl)-1-hydrazinyl-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 116914952 |
| Molecular Formula | C9H13Cl2N3 |
| Molecular Weight | 234.13 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-1-hydrazinyl-N,N-dimethylmethanamine |
| SMILES | CN(C)C(NN)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H13Cl2N3/c1-14(2)9(13-12)7-4-3-6(10)5-8(7)11/h3-5,9,13H,12H2,1-2H3 |
| InChIKey | WBXVYKYNYWAGGG-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.13 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|