C16H24O2 — CID 116926827
3,3-dimethyl-4-(2,3,5,6-tetramethylphenyl)butanoic acid (PubChem CID 116926827) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is 3,3-dimethyl-4-(2,3,5,6-tetramethylphenyl)butanoic acid.
| Compound Name | 3,3-dimethyl-4-(2,3,5,6-tetramethylphenyl)butanoic acid |
|---|---|
| PubChem CID | 116926827 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 3,3-dimethyl-4-(2,3,5,6-tetramethylphenyl)butanoic acid |
| SMILES | Cc1cc(C)c(C)c(CC(C)(C)CC(=O)O)c1C |
| InChI | InChI=1S/C16H24O2/c1-10-7-11(2)13(4)14(12(10)3)8-16(5,6)9-15(17)18/h7H,8-9H2,1-6H3,(H,17,18) |
| InChIKey | JGQJRDSUBQSGRJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |