C33H34O — CID 590126
2,2-dibenzyl-1-phenyl-3-(2,3,5,6-tetramethylphenyl)propan-1-one (PubChem CID 590126) has the molecular formula C33H34O and a molecular weight of 446.63 g/mol. Its IUPAC name is 2,2-dibenzyl-1-phenyl-3-(2,3,5,6-tetramethylphenyl)propan-1-one.
| Compound Name | 2,2-dibenzyl-1-phenyl-3-(2,3,5,6-tetramethylphenyl)propan-1-one |
|---|---|
| PubChem CID | 590126 |
| Molecular Formula | C33H34O |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | 2,2-dibenzyl-1-phenyl-3-(2,3,5,6-tetramethylphenyl)propan-1-one |
| SMILES | Cc1cc(C)c(C)c(CC(Cc2ccccc2)(Cc2ccccc2)C(=O)c2ccccc2)c1C |
| InChI | InChI=1S/C33H34O/c1-24-20-25(2)27(4)31(26(24)3)23-33(21-28-14-8-5-9-15-28,22-29-16-10-6-11-17-29)32(34)30-18-12-7-13-19-30/h5-20H,21-23H2,1-4H3 |
| InChIKey | XMKFUUVFGPJRCP-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |