About methyl 1-[(2,5-difluoro-4-methoxyphenyl)methyl]cyclopropane-1-carboxylate
methyl 1-[(2,5-difluoro-4-methoxyphenyl)methyl]cyclopropane-1-carboxylate (PubChem CID 116929868) has the molecular formula C13H14F2O3
and a molecular weight of 256.25 g/mol. Its IUPAC name is methyl 1-[(2,5-difluoro-4-methoxyphenyl)methyl]cyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[(2,5-difluoro-4-methoxyphenyl)methyl]cyclopropane-1-carboxylate |
| PubChem CID | 116929868 |
| Molecular Formula | C13H14F2O3 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | methyl 1-[(2,5-difluoro-4-methoxyphenyl)methyl]cyclopropane-1-carboxylate |
| SMILES | COC(=O)C1(Cc2cc(F)c(OC)cc2F)CC1 |
| InChI | InChI=1S/C13H14F2O3/c1-17-11-6-9(14)8(5-10(11)15)7-13(3-4-13)12(16)18-2/h5-6H,3-4,7H2,1-2H3 |
| InChIKey | HRMKVSWIEIMMLQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 1-[(2,5-difluoro-4-methoxyphenyl)methyl]cyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[(2,5-difluoro-4-methoxyphenyl)methyl]cyclopropane-1-carboxylate?
The IUPAC name of methyl 1-[(2,5-difluoro-4-methoxyphenyl)methyl]cyclopropane-1-carboxylate (CID 116929868) is methyl 1-[(2,5-difluoro-4-methoxyphenyl)methyl]cyclopropane-1-carboxylate.
What is the SMILES notation for methyl 1-[(2,5-difluoro-4-methoxyphenyl)methyl]cyclopropane-1-carboxylate?
The canonical SMILES for methyl 1-[(2,5-difluoro-4-methoxyphenyl)methyl]cyclopropane-1-carboxylate is COC(=O)C1(Cc2cc(F)c(OC)cc2F)CC1.
What is the InChIKey of methyl 1-[(2,5-difluoro-4-methoxyphenyl)methyl]cyclopropane-1-carboxylate?
The InChIKey is HRMKVSWIEIMMLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F2O3/c1-17-11-6-9(14)8(5-10(11)15)7-13(3-4-13)12(16)18-2/h5-6H,3-4,7H2,1-2H3.
What are the key properties of methyl 1-[(2,5-difluoro-4-methoxyphenyl)methyl]cyclopropane-1-carboxylate?
methyl 1-[(2,5-difluoro-4-methoxyphenyl)methyl]cyclopropane-1-carboxylate has a molecular weight of 256.25 g/mol, XLogP of 2.47, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[(2,5-difluoro-4-methoxyphenyl)methyl]cyclopropane-1-carboxylate is sourced from PubChem (CID 116929868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).