C11H20N2 — CID 116931194
N,3-dimethyl-2-(1H-pyrrol-3-ylmethyl)butan-1-amine (PubChem CID 116931194) has the molecular formula C11H20N2 and a molecular weight of 180.30 g/mol. Its IUPAC name is N,3-dimethyl-2-(1H-pyrrol-3-ylmethyl)butan-1-amine.
| Compound Name | N,3-dimethyl-2-(1H-pyrrol-3-ylmethyl)butan-1-amine |
|---|---|
| PubChem CID | 116931194 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.30 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | N,3-dimethyl-2-(1H-pyrrol-3-ylmethyl)butan-1-amine |
| SMILES | CNCC(Cc1cc[nH]c1)C(C)C |
| InChI | InChI=1S/C11H20N2/c1-9(2)11(8-12-3)6-10-4-5-13-7-10/h4-5,7,9,11-13H,6,8H2,1-3H3 |
| InChIKey | GREQPIYPNVGDHB-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.30 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |