C34H28CuN8O6S2 — CID 11693452
copper;bis(4-[[(E)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]-N-pyrimidin-2-ylbenzenesulfonamide) (PubChem CID 11693452) has the molecular formula C34H28CuN8O6S2 and a molecular weight of 772.33 g/mol. Its IUPAC name is copper;bis(4-[[(E)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]-N-pyrimidin-2-ylbenzenesulfonamide).
| Compound Name | copper;bis(4-[[(E)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]-N-pyrimidin-2-ylbenzenesulfonamide) |
|---|---|
| PubChem CID | 11693452 |
| Molecular Formula | C34H28CuN8O6S2 |
| Molecular Weight | 772.33 g/mol |
| Exact Mass | 771.09 |
| IUPAC Name | copper;bis(4-[[(E)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]-N-pyrimidin-2-ylbenzenesulfonamide) |
| SMILES | O=C1C=CC=C/C1=C\Nc1ccc(S(=O)(=O)Nc2ncccn2)cc1.O=C1C=CC=C/C1=C\Nc1ccc(S(=O)(=O)Nc2ncccn2)cc1.[Cu] |
| InChI | InChI=1S/2C17H14N4O3S.Cu/c2*22-16-5-2-1-4-13(16)12-20-14-6-8-15(9-7-14)25(23,24)21-17-18-10-3-11-19-17;/h2*1-12,20H,(H,18,19,21);/b2*13-12+; |
| InChIKey | SLISVHMBKZAOBD-ZVYVTKPGSA-N |
| XLogP | 4.53 |
| TPSA | 202.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.33 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|