C11H14Cl2N2O — CID 116944995
[3-(aminomethyl)oxetan-3-yl]-(2,4-dichlorophenyl)methanamine (PubChem CID 116944995) has the molecular formula C11H14Cl2N2O and a molecular weight of 261.15 g/mol. Its IUPAC name is [3-(aminomethyl)oxetan-3-yl]-(2,4-dichlorophenyl)methanamine.
| Compound Name | [3-(aminomethyl)oxetan-3-yl]-(2,4-dichlorophenyl)methanamine |
|---|---|
| PubChem CID | 116944995 |
| Molecular Formula | C11H14Cl2N2O |
| Molecular Weight | 261.15 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | [3-(aminomethyl)oxetan-3-yl]-(2,4-dichlorophenyl)methanamine |
| SMILES | NCC1(C(N)c2ccc(Cl)cc2Cl)COC1 |
| InChI | InChI=1S/C11H14Cl2N2O/c12-7-1-2-8(9(13)3-7)10(15)11(4-14)5-16-6-11/h1-3,10H,4-6,14-15H2 |
| InChIKey | WHGPTZBTBYQWRF-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.15 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |