C10H12Cl2N2 — CID 116947104
1-[amino-(2,4-dichlorophenyl)methyl]cyclopropan-1-amine (PubChem CID 116947104) has the molecular formula C10H12Cl2N2 and a molecular weight of 231.13 g/mol. Its IUPAC name is 1-[amino-(2,4-dichlorophenyl)methyl]cyclopropan-1-amine.
| Compound Name | 1-[amino-(2,4-dichlorophenyl)methyl]cyclopropan-1-amine |
|---|---|
| PubChem CID | 116947104 |
| Molecular Formula | C10H12Cl2N2 |
| Molecular Weight | 231.13 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 1-[amino-(2,4-dichlorophenyl)methyl]cyclopropan-1-amine |
| SMILES | NC(c1ccc(Cl)cc1Cl)C1(N)CC1 |
| InChI | InChI=1S/C10H12Cl2N2/c11-6-1-2-7(8(12)5-6)9(13)10(14)3-4-10/h1-2,5,9H,3-4,13-14H2 |
| InChIKey | DAOHALIGMALBKF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.13 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |